C25H34O6 — CID 58280717
[5-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxo-2-prop-2-enoyloxypentyl] prop-2-enoate (PubChem CID 58280717) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [5-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxo-2-prop-2-enoyloxypentyl] prop-2-enoate.
| Compound Name | [5-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxo-2-prop-2-enoyloxypentyl] prop-2-enoate |
|---|---|
| PubChem CID | 58280717 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [5-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxo-2-prop-2-enoyloxypentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(OC(=O)C=C)C(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H34O6/c1-9-21(27)30-15-20(31-22(28)10-2)19(26)12-11-16-13-17(24(3,4)5)23(29)18(14-16)25(6,7)8/h9-10,13-14,20,29H,1-2,11-12,15H2,3-8H3 |
| InChIKey | KFNJAOLEZJTMCY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|