C16H22O3 — CID 87674827
(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl prop-2-enoate (PubChem CID 87674827) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl prop-2-enoate.
| Compound Name | (4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 87674827 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1c(C)cc(C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C16H22O3/c1-7-14(17)19-9-12-10(2)8-13(16(4,5)6)15(18)11(12)3/h7-8,18H,1,9H2,2-6H3 |
| InChIKey | TWMPCMREBWKDEO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|