C14H23NO — CID 20574810
6-tert-butyl-2,4-dimethyl-3-(methylaminomethyl)phenol (PubChem CID 20574810) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 6-tert-butyl-2,4-dimethyl-3-(methylaminomethyl)phenol.
| Compound Name | 6-tert-butyl-2,4-dimethyl-3-(methylaminomethyl)phenol |
|---|---|
| PubChem CID | 20574810 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 6-tert-butyl-2,4-dimethyl-3-(methylaminomethyl)phenol |
| SMILES | CNCc1c(C)cc(C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C14H23NO/c1-9-7-12(14(3,4)5)13(16)10(2)11(9)8-15-6/h7,15-16H,8H2,1-6H3 |
| InChIKey | CHJBYJDRLVHLDC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |