C34H40O6S2-2 — CID 22019962
2,3-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methylsulfanyl]terephthalate (PubChem CID 22019962) has the molecular formula C34H40O6S2-2 and a molecular weight of 608.82 g/mol. Its IUPAC name is 2,3-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methylsulfanyl]terephthalate.
| Compound Name | 2,3-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methylsulfanyl]terephthalate |
|---|---|
| PubChem CID | 22019962 |
| Molecular Formula | C34H40O6S2-2 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 2,3-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methylsulfanyl]terephthalate |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CSc1c(C(=O)[O-])ccc(C(=O)[O-])c1SCc1c(C)cc(C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C34H42O6S2/c1-17-13-25(33(5,6)7)27(35)19(3)23(17)15-41-29-21(31(37)38)11-12-22(32(39)40)30(29)42-16-24-18(2)14-26(34(8,9)10)28(36)20(24)4/h11-14,35-36H,15-16H2,1-10H3,(H,37,38)(H,39,40)/p-2 |
| InChIKey | AKHUPODAMHBOMG-UHFFFAOYSA-L |
| XLogP | 6.24 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |