C19H28O5S — CID 150886598
3-[3-[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoic acid (PubChem CID 150886598) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-[3-[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoic acid.
| Compound Name | 3-[3-[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 150886598 |
| Molecular Formula | C19H28O5S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-[3-[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methoxy]-3-oxopropyl]sulfanylpropanoic acid |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1COC(=O)CCSCCC(=O)O |
| InChI | InChI=1S/C19H28O5S/c1-12-10-15(19(3,4)5)18(23)13(2)14(12)11-24-17(22)7-9-25-8-6-16(20)21/h10,23H,6-9,11H2,1-5H3,(H,20,21) |
| InChIKey | KXDHLROPFSLGDN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|