C18H28O3 — CID 19695108
(3,5-ditert-butyl-2-hydroxy-6-methylphenyl)methyl acetate (PubChem CID 19695108) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3,5-ditert-butyl-2-hydroxy-6-methylphenyl)methyl acetate.
| Compound Name | (3,5-ditert-butyl-2-hydroxy-6-methylphenyl)methyl acetate |
|---|---|
| PubChem CID | 19695108 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3,5-ditert-butyl-2-hydroxy-6-methylphenyl)methyl acetate |
| SMILES | CC(=O)OCc1c(C)c(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H28O3/c1-11-13(10-21-12(2)19)16(20)15(18(6,7)8)9-14(11)17(3,4)5/h9,20H,10H2,1-8H3 |
| InChIKey | MSNMJSJLBJLRIK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |