C41H64O6S2 — CID 14573012
3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-[[3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-3-oxopropyl]sulfanylmethylsulfanyl]propanoate (PubChem CID 14573012) has the molecular formula C41H64O6S2 and a molecular weight of 717.09 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-[[3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-3-oxopropyl]sulfanylmethylsulfanyl]propanoate.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-[[3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-3-oxopropyl]sulfanylmethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 14573012 |
| Molecular Formula | C41H64O6S2 |
| Molecular Weight | 717.09 g/mol |
| Exact Mass | 716.41 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-[[3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-3-oxopropyl]sulfanylmethylsulfanyl]propanoate |
| SMILES | CC(C)(C)c1cc(CCCOC(=O)CCSCSCCC(=O)OCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C41H64O6S2/c1-38(2,3)30-23-28(24-31(36(30)44)39(4,5)6)15-13-19-46-34(42)17-21-48-27-49-22-18-35(43)47-20-14-16-29-25-32(40(7,8)9)37(45)33(26-29)41(10,11)12/h23-26,44-45H,13-22,27H2,1-12H3 |
| InChIKey | FNTNKRQJYVVAIX-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.09 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|