C40H60N2O8S2 — CID 88797167
2-[[2-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethylsulfanylamino]-2-oxoacetyl]amino]sulfanylethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 88797167) has the molecular formula C40H60N2O8S2 and a molecular weight of 761.06 g/mol. Its IUPAC name is 2-[[2-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethylsulfanylamino]-2-oxoacetyl]amino]sulfanylethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 2-[[2-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethylsulfanylamino]-2-oxoacetyl]amino]sulfanylethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 88797167 |
| Molecular Formula | C40H60N2O8S2 |
| Molecular Weight | 761.06 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | 2-[[2-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethylsulfanylamino]-2-oxoacetyl]amino]sulfanylethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCCSNC(=O)C(=O)NSCCOC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C40H60N2O8S2/c1-37(2,3)27-21-25(22-28(33(27)45)38(4,5)6)13-15-31(43)49-17-19-51-41-35(47)36(48)42-52-20-18-50-32(44)16-14-26-23-29(39(7,8)9)34(46)30(24-26)40(10,11)12/h21-24,45-46H,13-20H2,1-12H3,(H,41,47)(H,42,48) |
| InChIKey | MDBHBJMJOZVUCF-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.06 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|