C32H54O7 — CID 161460542
2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl 2,2-dimethylbutanoate;methyl 2,2-dimethylbutanoate (PubChem CID 161460542) has the molecular formula C32H54O7 and a molecular weight of 550.78 g/mol. Its IUPAC name is 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl 2,2-dimethylbutanoate;methyl 2,2-dimethylbutanoate.
| Compound Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl 2,2-dimethylbutanoate;methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 161460542 |
| Molecular Formula | C32H54O7 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl 2,2-dimethylbutanoate;methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC.CCC(C)(C)C(=O)OCCOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H40O5.C7H14O2/c1-10-25(8,9)22(28)30-14-13-29-20(26)12-11-17-15-18(23(2,3)4)21(27)19(16-17)24(5,6)7;1-5-7(2,3)6(8)9-4/h15-16,27H,10-14H2,1-9H3;5H2,1-4H3 |
| InChIKey | WBSYOVJGCSBIFU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|