C20H32O4S — CID 57172607
2-hydroxyethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanyl]propanoate (PubChem CID 57172607) has the molecular formula C20H32O4S and a molecular weight of 368.54 g/mol. Its IUPAC name is 2-hydroxyethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanyl]propanoate.
| Compound Name | 2-hydroxyethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 57172607 |
| Molecular Formula | C20H32O4S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-hydroxyethyl 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylsulfanyl]propanoate |
| SMILES | CC(C)(C)c1cc(CSCCC(=O)OCCO)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H32O4S/c1-19(2,3)15-11-14(12-16(18(15)23)20(4,5)6)13-25-10-7-17(22)24-9-8-21/h11-12,21,23H,7-10,13H2,1-6H3 |
| InChIKey | AHVLEIJGXPQLKK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|