C34H42O6S2 — CID 22019963
2,3-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methylsulfanyl]terephthalic acid (PubChem CID 22019963) has the molecular formula C34H42O6S2 and a molecular weight of 610.84 g/mol. Its IUPAC name is 2,3-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methylsulfanyl]terephthalic acid.
| Compound Name | 2,3-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methylsulfanyl]terephthalic acid |
|---|---|
| PubChem CID | 22019963 |
| Molecular Formula | C34H42O6S2 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | 2,3-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methylsulfanyl]terephthalic acid |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CSc1c(C(=O)O)ccc(C(=O)O)c1SCc1c(C)cc(C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C34H42O6S2/c1-17-13-25(33(5,6)7)27(35)19(3)23(17)15-41-29-21(31(37)38)11-12-22(32(39)40)30(29)42-16-24-18(2)14-26(34(8,9)10)28(36)20(24)4/h11-14,35-36H,15-16H2,1-10H3,(H,37,38)(H,39,40) |
| InChIKey | AKHUPODAMHBOMG-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |