C41H61O4P — CID 88793892
3-[bis(2,4-ditert-butylphenoxy)phosphorylmethyl]-6-tert-butyl-2,4-dimethylphenol (PubChem CID 88793892) has the molecular formula C41H61O4P and a molecular weight of 648.91 g/mol. Its IUPAC name is 3-[bis(2,4-ditert-butylphenoxy)phosphorylmethyl]-6-tert-butyl-2,4-dimethylphenol.
| Compound Name | 3-[bis(2,4-ditert-butylphenoxy)phosphorylmethyl]-6-tert-butyl-2,4-dimethylphenol |
|---|---|
| PubChem CID | 88793892 |
| Molecular Formula | C41H61O4P |
| Molecular Weight | 648.91 g/mol |
| Exact Mass | 648.43 |
| IUPAC Name | 3-[bis(2,4-ditert-butylphenoxy)phosphorylmethyl]-6-tert-butyl-2,4-dimethylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CP(=O)(Oc1ccc(C(C)(C)C)cc1C(C)(C)C)Oc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C41H61O4P/c1-26-22-33(41(15,16)17)36(42)27(2)30(26)25-46(43,44-34-20-18-28(37(3,4)5)23-31(34)39(9,10)11)45-35-21-19-29(38(6,7)8)24-32(35)40(12,13)14/h18-24,42H,25H2,1-17H3 |
| InChIKey | GTOAEQLVVPDDEA-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.91 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|