C31H41O4P — CID 88760648
4-[bis(2,4-dimethylphenoxy)phosphorylmethyl]-2,6-ditert-butylphenol (PubChem CID 88760648) has the molecular formula C31H41O4P and a molecular weight of 508.64 g/mol. Its IUPAC name is 4-[bis(2,4-dimethylphenoxy)phosphorylmethyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[bis(2,4-dimethylphenoxy)phosphorylmethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 88760648 |
| Molecular Formula | C31H41O4P |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 4-[bis(2,4-dimethylphenoxy)phosphorylmethyl]-2,6-ditert-butylphenol |
| SMILES | Cc1ccc(OP(=O)(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)Oc2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C31H41O4P/c1-20-11-13-27(22(3)15-20)34-36(33,35-28-14-12-21(2)16-23(28)4)19-24-17-25(30(5,6)7)29(32)26(18-24)31(8,9)10/h11-18,32H,19H2,1-10H3 |
| InChIKey | JGGXABMECBJMFQ-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|