C14H22ClO4P — CID 88804359
2-tert-butyl-6-chloro-4-diethoxyphosphorylphenol (PubChem CID 88804359) has the molecular formula C14H22ClO4P and a molecular weight of 320.75 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-4-diethoxyphosphorylphenol.
| Compound Name | 2-tert-butyl-6-chloro-4-diethoxyphosphorylphenol |
|---|---|
| PubChem CID | 88804359 |
| Molecular Formula | C14H22ClO4P |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-tert-butyl-6-chloro-4-diethoxyphosphorylphenol |
| SMILES | CCOP(=O)(OCC)c1cc(Cl)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H22ClO4P/c1-6-18-20(17,19-7-2)10-8-11(14(3,4)5)13(16)12(15)9-10/h8-9,16H,6-7H2,1-5H3 |
| InChIKey | PIIOVPOFVFSTKY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|