C16H24ClNO2 — CID 134094274
3-tert-butyl-5-chloro-N-(2,2-dimethylpropyl)-4-hydroxybenzamide (PubChem CID 134094274) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-tert-butyl-5-chloro-N-(2,2-dimethylpropyl)-4-hydroxybenzamide.
| Compound Name | 3-tert-butyl-5-chloro-N-(2,2-dimethylpropyl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 134094274 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-tert-butyl-5-chloro-N-(2,2-dimethylpropyl)-4-hydroxybenzamide |
| SMILES | CC(C)(C)CNC(=O)c1cc(Cl)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24ClNO2/c1-15(2,3)9-18-14(20)10-7-11(16(4,5)6)13(19)12(17)8-10/h7-8,19H,9H2,1-6H3,(H,18,20) |
| InChIKey | UZSZAPYZGKCXJF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |