C18H31O3P — CID 171526978
2,6-ditert-butyl-4-[[ethoxy(methoxy)phosphanyl]methyl]phenol (PubChem CID 171526978) has the molecular formula C18H31O3P and a molecular weight of 326.42 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[ethoxy(methoxy)phosphanyl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[ethoxy(methoxy)phosphanyl]methyl]phenol |
|---|---|
| PubChem CID | 171526978 |
| Molecular Formula | C18H31O3P |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2,6-ditert-butyl-4-[[ethoxy(methoxy)phosphanyl]methyl]phenol |
| SMILES | CCOP(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)OC |
| InChI | InChI=1S/C18H31O3P/c1-9-21-22(20-8)12-13-10-14(17(2,3)4)16(19)15(11-13)18(5,6)7/h10-11,19H,9,12H2,1-8H3 |
| InChIKey | TXTFNMXMIQIOMA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|