C13H21O4P — CID 71222353
(3,5-dimethoxyphenyl)methyl-diethoxyphosphane (PubChem CID 71222353) has the molecular formula C13H21O4P and a molecular weight of 272.28 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)methyl-diethoxyphosphane.
| Compound Name | (3,5-dimethoxyphenyl)methyl-diethoxyphosphane |
|---|---|
| PubChem CID | 71222353 |
| Molecular Formula | C13H21O4P |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (3,5-dimethoxyphenyl)methyl-diethoxyphosphane |
| SMILES | CCOP(Cc1cc(OC)cc(OC)c1)OCC |
| InChI | InChI=1S/C13H21O4P/c1-5-16-18(17-6-2)10-11-7-12(14-3)9-13(8-11)15-4/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | XWNLQQLNWRJIJA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|