C13H21O6P — CID 10828324
(3,5-dimethoxyphenyl)methyl diethyl phosphate (PubChem CID 10828324) has the molecular formula C13H21O6P and a molecular weight of 304.28 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)methyl diethyl phosphate.
| Compound Name | (3,5-dimethoxyphenyl)methyl diethyl phosphate |
|---|---|
| PubChem CID | 10828324 |
| Molecular Formula | C13H21O6P |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3,5-dimethoxyphenyl)methyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H21O6P/c1-5-17-20(14,18-6-2)19-10-11-7-12(15-3)9-13(8-11)16-4/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | GWZDRGNPUJRUFW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|