C18H33O6PSi — CID 175357377
2-[[3-(diethoxyphosphorylmethyl)-5-methoxyphenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 175357377) has the molecular formula C18H33O6PSi and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[[3-(diethoxyphosphorylmethyl)-5-methoxyphenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(diethoxyphosphorylmethyl)-5-methoxyphenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 175357377 |
| Molecular Formula | C18H33O6PSi |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[[3-(diethoxyphosphorylmethyl)-5-methoxyphenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | CCOP(=O)(Cc1cc(OC)cc(OCOCC[Si](C)(C)C)c1)OCC |
| InChI | InChI=1S/C18H33O6PSi/c1-7-23-25(19,24-8-2)14-16-11-17(20-3)13-18(12-16)22-15-21-9-10-26(4,5)6/h11-13H,7-10,14-15H2,1-6H3 |
| InChIKey | QWHDHQXDQJENDO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|