C27H46O5Si — CID 10624504
tert-butyl-[[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-bis(methoxymethoxy)phenyl]methoxy]-dimethylsilane (PubChem CID 10624504) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is tert-butyl-[[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-bis(methoxymethoxy)phenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-bis(methoxymethoxy)phenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10624504 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | tert-butyl-[[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-bis(methoxymethoxy)phenyl]methoxy]-dimethylsilane |
| SMILES | COCOc1cc(CO[Si](C)(C)C(C)(C)C)cc(OCOC)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C27H46O5Si/c1-21(2)12-11-13-22(3)14-15-24-25(30-19-28-7)16-23(17-26(24)31-20-29-8)18-32-33(9,10)27(4,5)6/h12,14,16-17H,11,13,15,18-20H2,1-10H3/b22-14+ |
| InChIKey | PYNYDGKJXOGSHY-HYARGMPZSA-N |
| XLogP | 7.41 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|