C17H28NiO4P+ — CID 158653418
(3,5-ditert-butyl-4-hydroxyphenyl)methoxy-ethoxy-oxophosphanium;nickel (PubChem CID 158653418) has the molecular formula C17H28NiO4P+ and a molecular weight of 386.07 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-ethoxy-oxophosphanium;nickel.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-ethoxy-oxophosphanium;nickel |
|---|---|
| PubChem CID | 158653418 |
| Molecular Formula | C17H28NiO4P+ |
| Molecular Weight | 386.07 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-ethoxy-oxophosphanium;nickel |
| SMILES | CCO[P+](=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.[Ni] |
| InChI | InChI=1S/C17H27O4P.Ni/c1-8-20-22(19)21-11-12-9-13(16(2,3)4)15(18)14(10-12)17(5,6)7;/h9-10H,8,11H2,1-7H3;/p+1 |
| InChIKey | JGJMIIAVCOTJQU-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.07 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|