C18H30O5P+ — CID 172857990
(3,5-ditert-butyl-4-hydroxyphenyl)methoxy-(1-hydroxypropoxy)-oxophosphanium (PubChem CID 172857990) has the molecular formula C18H30O5P+ and a molecular weight of 357.41 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-(1-hydroxypropoxy)-oxophosphanium.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-(1-hydroxypropoxy)-oxophosphanium |
|---|---|
| PubChem CID | 172857990 |
| Molecular Formula | C18H30O5P+ |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-(1-hydroxypropoxy)-oxophosphanium |
| SMILES | CCC(O)O[P+](=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29O5P/c1-8-15(19)23-24(21)22-11-12-9-13(17(2,3)4)16(20)14(10-12)18(5,6)7/h9-10,15,19H,8,11H2,1-7H3/p+1 |
| InChIKey | YSMVQTCHNJJEEW-UHFFFAOYSA-O |
| XLogP | 4.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|