C18H32O2Si — CID 18406218
2,6-ditert-butyl-4-(trimethylsilyloxymethyl)phenol (PubChem CID 18406218) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(trimethylsilyloxymethyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(trimethylsilyloxymethyl)phenol |
|---|---|
| PubChem CID | 18406218 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2,6-ditert-butyl-4-(trimethylsilyloxymethyl)phenol |
| SMILES | CC(C)(C)c1cc(CO[Si](C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H32O2Si/c1-17(2,3)14-10-13(12-20-21(7,8)9)11-15(16(14)19)18(4,5)6/h10-11,19H,12H2,1-9H3 |
| InChIKey | IZNJOLBYWBFODQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|