About bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium
bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium (PubChem CID 87112308) has the molecular formula C38H62O5P+
and a molecular weight of 629.88 g/mol. Its IUPAC name is bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium.
Molecular Properties
| Compound Name | bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium |
| PubChem CID | 87112308 |
| Molecular Formula | C38H62O5P+ |
| Molecular Weight | 629.88 g/mol |
| Exact Mass | 629.43 |
| IUPAC Name | bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium |
| SMILES | CCC(CC)(O[P+](=O)OC(CC)(CC)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H61O5P/c1-17-37(18-2,25-21-27(33(5,6)7)31(39)28(22-25)34(8,9)10)42-44(41)43-38(19-3,20-4)26-23-29(35(11,12)13)32(40)30(24-26)36(14,15)16/h21-24H,17-20H2,1-16H3,(H-,39,40)/p+1 |
| InChIKey | YDWIKVMQYVNHCX-UHFFFAOYSA-O |
| XLogP | 11.71 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.88 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium?
The IUPAC name of bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium (CID 87112308) is bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium.
What is the SMILES notation for bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium?
The canonical SMILES for bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium is CCC(CC)(O[P+](=O)OC(CC)(CC)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium?
The InChIKey is YDWIKVMQYVNHCX-UHFFFAOYSA-O. The full InChI is InChI=1S/C38H61O5P/c1-17-37(18-2,25-21-27(33(5,6)7)31(39)28(22-25)34(8,9)10)42-44(41)43-38(19-3,20-4)26-23-29(35(11,12)13)32(40)30(24-26)36(14,15)16/h21-24H,17-20H2,1-16H3,(H-,39,40)/p+1.
What are the key properties of bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium?
bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium has a molecular weight of 629.88 g/mol, XLogP of 11.71, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)pentan-3-yloxy]-oxophosphanium is sourced from PubChem (CID 87112308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).