C37H60O6 — CID 175116291
2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;2-ethylbutane-1,2-diol (PubChem CID 175116291) has the molecular formula C37H60O6 and a molecular weight of 600.88 g/mol. Its IUPAC name is 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;2-ethylbutane-1,2-diol.
| Compound Name | 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;2-ethylbutane-1,2-diol |
|---|---|
| PubChem CID | 175116291 |
| Molecular Formula | C37H60O6 |
| Molecular Weight | 600.88 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;2-ethylbutane-1,2-diol |
| SMILES | CC(C)(C)c1cc(C(C)(C(=O)O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O.CCC(O)(CC)CO |
| InChI | InChI=1S/C31H46O4.C6H14O2/c1-27(2,3)20-14-18(15-21(24(20)32)28(4,5)6)31(13,26(34)35)19-16-22(29(7,8)9)25(33)23(17-19)30(10,11)12;1-3-6(8,4-2)5-7/h14-17,32-33H,1-13H3,(H,34,35);7-8H,3-5H2,1-2H3 |
| InChIKey | BNZUKRAJJLNQJC-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.88 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |