C27H53O7P — CID 87459267
2-butyl-2-ethylpropane-1,3-diol;phosphoric acid;2,4,6-tritert-butylphenol (PubChem CID 87459267) has the molecular formula C27H53O7P and a molecular weight of 520.69 g/mol. Its IUPAC name is 2-butyl-2-ethylpropane-1,3-diol;phosphoric acid;2,4,6-tritert-butylphenol.
| Compound Name | 2-butyl-2-ethylpropane-1,3-diol;phosphoric acid;2,4,6-tritert-butylphenol |
|---|---|
| PubChem CID | 87459267 |
| Molecular Formula | C27H53O7P |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.35 |
| IUPAC Name | 2-butyl-2-ethylpropane-1,3-diol;phosphoric acid;2,4,6-tritert-butylphenol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.CCCCC(CC)(CO)CO.O=P(O)(O)O |
| InChI | InChI=1S/C18H30O.C9H20O2.H3O4P/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9;1-3-5-6-9(4-2,7-10)8-11;1-5(2,3)4/h10-11,19H,1-9H3;10-11H,3-8H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | NRAWEZBKFADHFO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|