C27H51O6P — CID 66793935
2-butyl-2-ethyl-1-(2,4,6-tritert-butylphenyl)propane-1,3-diol;phosphoric acid (PubChem CID 66793935) has the molecular formula C27H51O6P and a molecular weight of 502.67 g/mol. Its IUPAC name is 2-butyl-2-ethyl-1-(2,4,6-tritert-butylphenyl)propane-1,3-diol;phosphoric acid.
| Compound Name | 2-butyl-2-ethyl-1-(2,4,6-tritert-butylphenyl)propane-1,3-diol;phosphoric acid |
|---|---|
| PubChem CID | 66793935 |
| Molecular Formula | C27H51O6P |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 2-butyl-2-ethyl-1-(2,4,6-tritert-butylphenyl)propane-1,3-diol;phosphoric acid |
| SMILES | CCCCC(CC)(CO)C(O)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C27H48O2.H3O4P/c1-12-14-15-27(13-2,18-28)23(29)22-20(25(6,7)8)16-19(24(3,4)5)17-21(22)26(9,10)11;1-5(2,3)4/h16-17,23,28-29H,12-15,18H2,1-11H3;(H3,1,2,3,4) |
| InChIKey | XHJURWUPNGJJAY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|