C33H44O2 — CID 174840779
1-[2,3-bis(2-phenylpropan-2-yl)phenyl]-2-butyl-2-ethylpropane-1,3-diol (PubChem CID 174840779) has the molecular formula C33H44O2 and a molecular weight of 472.71 g/mol. Its IUPAC name is 1-[2,3-bis(2-phenylpropan-2-yl)phenyl]-2-butyl-2-ethylpropane-1,3-diol.
| Compound Name | 1-[2,3-bis(2-phenylpropan-2-yl)phenyl]-2-butyl-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 174840779 |
| Molecular Formula | C33H44O2 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | 1-[2,3-bis(2-phenylpropan-2-yl)phenyl]-2-butyl-2-ethylpropane-1,3-diol |
| SMILES | CCCCC(CC)(CO)C(O)c1cccc(C(C)(C)c2ccccc2)c1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C33H44O2/c1-7-9-23-33(8-2,24-34)30(35)27-21-16-22-28(31(3,4)25-17-12-10-13-18-25)29(27)32(5,6)26-19-14-11-15-20-26/h10-22,30,34-35H,7-9,23-24H2,1-6H3 |
| InChIKey | YMFOBKOVGRJJGC-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |