C26H28O3 — CID 174387822
[2,3-bis(2-phenylpropan-2-yl)phenyl] 2-hydroxyacetate (PubChem CID 174387822) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is [2,3-bis(2-phenylpropan-2-yl)phenyl] 2-hydroxyacetate.
| Compound Name | [2,3-bis(2-phenylpropan-2-yl)phenyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 174387822 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [2,3-bis(2-phenylpropan-2-yl)phenyl] 2-hydroxyacetate |
| SMILES | CC(C)(c1ccccc1)c1cccc(OC(=O)CO)c1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H28O3/c1-25(2,19-12-7-5-8-13-19)21-16-11-17-22(29-23(28)18-27)24(21)26(3,4)20-14-9-6-10-15-20/h5-17,27H,18H2,1-4H3 |
| InChIKey | YWDSQARHMQPTGA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|