C27H50O2 — CID 141204509
2-butyl-2-ethylpropane-1,3-diol;1,3,5-tritert-butylbenzene (PubChem CID 141204509) has the molecular formula C27H50O2 and a molecular weight of 406.70 g/mol. Its IUPAC name is 2-butyl-2-ethylpropane-1,3-diol;1,3,5-tritert-butylbenzene.
| Compound Name | 2-butyl-2-ethylpropane-1,3-diol;1,3,5-tritert-butylbenzene |
|---|---|
| PubChem CID | 141204509 |
| Molecular Formula | C27H50O2 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 406.38 |
| IUPAC Name | 2-butyl-2-ethylpropane-1,3-diol;1,3,5-tritert-butylbenzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1.CCCCC(CC)(CO)CO |
| InChI | InChI=1S/C18H30.C9H20O2/c1-16(2,3)13-10-14(17(4,5)6)12-15(11-13)18(7,8)9;1-3-5-6-9(4-2,7-10)8-11/h10-12H,1-9H3;10-11H,3-8H2,1-2H3 |
| InChIKey | JGGBTSFPTHWQCJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |