C15H34O4 — CID 161043370
2-butyl-2-ethylpropane-1,3-diol;hexane-1,2-diol (PubChem CID 161043370) has the molecular formula C15H34O4 and a molecular weight of 278.43 g/mol. Its IUPAC name is 2-butyl-2-ethylpropane-1,3-diol;hexane-1,2-diol.
| Compound Name | 2-butyl-2-ethylpropane-1,3-diol;hexane-1,2-diol |
|---|---|
| PubChem CID | 161043370 |
| Molecular Formula | C15H34O4 |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 2-butyl-2-ethylpropane-1,3-diol;hexane-1,2-diol |
| SMILES | CCCCC(CC)(CO)CO.CCCCC(O)CO |
| InChI | InChI=1S/C9H20O2.C6H14O2/c1-3-5-6-9(4-2,7-10)8-11;1-2-3-4-6(8)5-7/h10-11H,3-8H2,1-2H3;6-8H,2-5H2,1H3 |
| InChIKey | UBEAZPFIYWIXTM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |