C18H40O4 — CID 157049942
2-butyl-2-ethylpropane-1,3-diol;nonane-1,9-diol (PubChem CID 157049942) has the molecular formula C18H40O4 and a molecular weight of 320.51 g/mol. Its IUPAC name is 2-butyl-2-ethylpropane-1,3-diol;nonane-1,9-diol.
| Compound Name | 2-butyl-2-ethylpropane-1,3-diol;nonane-1,9-diol |
|---|---|
| PubChem CID | 157049942 |
| Molecular Formula | C18H40O4 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 2-butyl-2-ethylpropane-1,3-diol;nonane-1,9-diol |
| SMILES | CCCCC(CC)(CO)CO.OCCCCCCCCCO |
| InChI | InChI=1S/2C9H20O2/c1-3-5-6-9(4-2,7-10)8-11;10-8-6-4-2-1-3-5-7-9-11/h10-11H,3-8H2,1-2H3;10-11H,1-9H2 |
| InChIKey | AABPVFAIQDPGEW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|