C18H40O4 — CID 87084275
2-butyl-2-ethylpropane-1,3-diol (PubChem CID 87084275) has the molecular formula C18H40O4 and a molecular weight of 320.51 g/mol. Its IUPAC name is 2-butyl-2-ethylpropane-1,3-diol.
| Compound Name | 2-butyl-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 87084275 |
| Molecular Formula | C18H40O4 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 2-butyl-2-ethylpropane-1,3-diol |
| SMILES | CCCCC(CC)(CO)CO.CCCCC(CC)(CO)CO |
| InChI | InChI=1S/2C9H20O2/c2*1-3-5-6-9(4-2,7-10)8-11/h2*10-11H,3-8H2,1-2H3 |
| InChIKey | BGIPUMUFMJVJQF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |