C27H51O5P — CID 175056786
phosphorous acid;4-(2,4,6-tritert-butylphenyl)nonane-1,3-diol (PubChem CID 175056786) has the molecular formula C27H51O5P and a molecular weight of 486.67 g/mol. Its IUPAC name is phosphorous acid;4-(2,4,6-tritert-butylphenyl)nonane-1,3-diol.
| Compound Name | phosphorous acid;4-(2,4,6-tritert-butylphenyl)nonane-1,3-diol |
|---|---|
| PubChem CID | 175056786 |
| Molecular Formula | C27H51O5P |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | phosphorous acid;4-(2,4,6-tritert-butylphenyl)nonane-1,3-diol |
| SMILES | CCCCCC(c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C)C(O)CCO.OP(O)O |
| InChI | InChI=1S/C27H48O2.H3O3P/c1-11-12-13-14-20(23(29)15-16-28)24-21(26(5,6)7)17-19(25(2,3)4)18-22(24)27(8,9)10;1-4(2)3/h17-18,20,23,28-29H,11-16H2,1-10H3;1-3H |
| InChIKey | YQRQFTJOWHLNOC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|