C34H56O8P2 — CID 54322548
[3-(2,4-ditert-butyl-6-methylphenyl)-2-(dihydroxyphosphanyloxymethyl)-2-(hydroxymethyl)-3-(2-octylphenoxy)propyl] dihydrogen phosphite (PubChem CID 54322548) has the molecular formula C34H56O8P2 and a molecular weight of 654.76 g/mol. Its IUPAC name is [3-(2,4-ditert-butyl-6-methylphenyl)-2-(dihydroxyphosphanyloxymethyl)-2-(hydroxymethyl)-3-(2-octylphenoxy)propyl] dihydrogen phosphite.
| Compound Name | [3-(2,4-ditert-butyl-6-methylphenyl)-2-(dihydroxyphosphanyloxymethyl)-2-(hydroxymethyl)-3-(2-octylphenoxy)propyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 54322548 |
| Molecular Formula | C34H56O8P2 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | [3-(2,4-ditert-butyl-6-methylphenyl)-2-(dihydroxyphosphanyloxymethyl)-2-(hydroxymethyl)-3-(2-octylphenoxy)propyl] dihydrogen phosphite |
| SMILES | CCCCCCCCc1ccccc1OC(c1c(C)cc(C(C)(C)C)cc1C(C)(C)C)C(CO)(COP(O)O)COP(O)O |
| InChI | InChI=1S/C34H56O8P2/c1-9-10-11-12-13-14-17-26-18-15-16-19-29(26)42-31(34(22-35,23-40-43(36)37)24-41-44(38)39)30-25(2)20-27(32(3,4)5)21-28(30)33(6,7)8/h15-16,18-21,31,35-39H,9-14,17,22-24H2,1-8H3 |
| InChIKey | SSQDBJAPDHFSRP-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|