C35H60O9P2 — CID 175414345
2,2-bis(hydroxymethyl)propane-1,3-diol;(2,6-ditert-butyl-4-methylphenyl) dihydroxyphosphanyl (2-nonylphenyl) phosphite (PubChem CID 175414345) has the molecular formula C35H60O9P2 and a molecular weight of 686.80 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;(2,6-ditert-butyl-4-methylphenyl) dihydroxyphosphanyl (2-nonylphenyl) phosphite.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;(2,6-ditert-butyl-4-methylphenyl) dihydroxyphosphanyl (2-nonylphenyl) phosphite |
|---|---|
| PubChem CID | 175414345 |
| Molecular Formula | C35H60O9P2 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 686.37 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;(2,6-ditert-butyl-4-methylphenyl) dihydroxyphosphanyl (2-nonylphenyl) phosphite |
| SMILES | CCCCCCCCCc1ccccc1OP(Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C)OP(O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C30H48O5P2.C5H12O4/c1-9-10-11-12-13-14-15-18-24-19-16-17-20-27(24)33-37(35-36(31)32)34-28-25(29(3,4)5)21-23(2)22-26(28)30(6,7)8;6-1-5(2-7,3-8)4-9/h16-17,19-22,31-32H,9-15,18H2,1-8H3;6-9H,1-4H2 |
| InChIKey | WUCMPHDTXKFVRJ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|