C61H101O3P — CID 88638189
[2-[9,9-bis[4-methyl-2,6-bis(2,4,4-trimethylpentan-2-yl)phenyl]nonyl]phenyl] dihydrogen phosphite (PubChem CID 88638189) has the molecular formula C61H101O3P and a molecular weight of 913.45 g/mol. Its IUPAC name is [2-[9,9-bis[4-methyl-2,6-bis(2,4,4-trimethylpentan-2-yl)phenyl]nonyl]phenyl] dihydrogen phosphite.
| Compound Name | [2-[9,9-bis[4-methyl-2,6-bis(2,4,4-trimethylpentan-2-yl)phenyl]nonyl]phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 88638189 |
| Molecular Formula | C61H101O3P |
| Molecular Weight | 913.45 g/mol |
| Exact Mass | 912.75 |
| IUPAC Name | [2-[9,9-bis[4-methyl-2,6-bis(2,4,4-trimethylpentan-2-yl)phenyl]nonyl]phenyl] dihydrogen phosphite |
| SMILES | Cc1cc(C(C)(C)CC(C)(C)C)c(C(CCCCCCCCc2ccccc2OP(O)O)c2c(C(C)(C)CC(C)(C)C)cc(C)cc2C(C)(C)CC(C)(C)C)c(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C61H101O3P/c1-43-35-47(58(15,16)39-54(3,4)5)52(48(36-43)59(17,18)40-55(6,7)8)46(33-28-26-24-23-25-27-31-45-32-29-30-34-51(45)64-65(62)63)53-49(60(19,20)41-56(9,10)11)37-44(2)38-50(53)61(21,22)42-57(12,13)14/h29-30,32,34-38,46,62-63H,23-28,31,33,39-42H2,1-22H3 |
| InChIKey | SPTKEFBREQBWQU-UHFFFAOYSA-N |
| XLogP | 18.85 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.45 |
| LogP ≤ 5 | 18.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|