C20H40O10P2 — CID 159052970
2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite;2-nonylphenol (PubChem CID 159052970) has the molecular formula C20H40O10P2 and a molecular weight of 502.48 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite;2-nonylphenol.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite;2-nonylphenol |
|---|---|
| PubChem CID | 159052970 |
| Molecular Formula | C20H40O10P2 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;dihydroxyphosphanyl dihydrogen phosphite;2-nonylphenol |
| SMILES | CCCCCCCCCc1ccccc1O.OCC(CO)(CO)CO.OP(O)OP(O)O |
| InChI | InChI=1S/C15H24O.C5H12O4.H4O5P2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;6-1-5(2-7,3-8)4-9;1-6(2)5-7(3)4/h9-10,12-13,16H,2-8,11H2,1H3;6-9H,1-4H2;1-4H |
| InChIKey | JXMUQNHGHPTVTN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 191.30 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|