C66H111O3P — CID 87455418
tris[1-(2,4-ditert-butylphenyl)octyl] phosphite (PubChem CID 87455418) has the molecular formula C66H111O3P and a molecular weight of 983.58 g/mol. Its IUPAC name is tris[1-(2,4-ditert-butylphenyl)octyl] phosphite.
| Compound Name | tris[1-(2,4-ditert-butylphenyl)octyl] phosphite |
|---|---|
| PubChem CID | 87455418 |
| Molecular Formula | C66H111O3P |
| Molecular Weight | 983.58 g/mol |
| Exact Mass | 982.83 |
| IUPAC Name | tris[1-(2,4-ditert-butylphenyl)octyl] phosphite |
| SMILES | CCCCCCCC(OP(OC(CCCCCCC)c1ccc(C(C)(C)C)cc1C(C)(C)C)OC(CCCCCCC)c1ccc(C(C)(C)C)cc1C(C)(C)C)c1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C66H111O3P/c1-22-25-28-31-34-37-58(52-43-40-49(61(4,5)6)46-55(52)64(13,14)15)67-70(68-59(38-35-32-29-26-23-2)53-44-41-50(62(7,8)9)47-56(53)65(16,17)18)69-60(39-36-33-30-27-24-3)54-45-42-51(63(10,11)12)48-57(54)66(19,20)21/h40-48,58-60H,22-39H2,1-21H3 |
| InChIKey | NLFHNVWBIHHAAK-UHFFFAOYSA-N |
| XLogP | 22.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.58 |
| LogP ≤ 5 | 22.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|