C36H61O3P — CID 141397811
bis(2,4-ditert-butylphenyl)-dihydroxy-octoxy-λ5-phosphane (PubChem CID 141397811) has the molecular formula C36H61O3P and a molecular weight of 572.86 g/mol. Its IUPAC name is bis(2,4-ditert-butylphenyl)-dihydroxy-octoxy-λ5-phosphane.
| Compound Name | bis(2,4-ditert-butylphenyl)-dihydroxy-octoxy-λ5-phosphane |
|---|---|
| PubChem CID | 141397811 |
| Molecular Formula | C36H61O3P |
| Molecular Weight | 572.86 g/mol |
| Exact Mass | 572.44 |
| IUPAC Name | bis(2,4-ditert-butylphenyl)-dihydroxy-octoxy-λ5-phosphane |
| SMILES | CCCCCCCCOP(O)(O)(c1ccc(C(C)(C)C)cc1C(C)(C)C)c1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C36H61O3P/c1-14-15-16-17-18-19-24-39-40(37,38,31-22-20-27(33(2,3)4)25-29(31)35(8,9)10)32-23-21-28(34(5,6)7)26-30(32)36(11,12)13/h20-23,25-26,37-38H,14-19,24H2,1-13H3 |
| InChIKey | IGBCKECIYPIYRU-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.86 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|