C38H68O13P2 — CID 158272519
bis(1-(2,4-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol);dihydroxyphosphanyl dihydrogen phosphite (PubChem CID 158272519) has the molecular formula C38H68O13P2 and a molecular weight of 794.90 g/mol. Its IUPAC name is bis(1-(2,4-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol);dihydroxyphosphanyl dihydrogen phosphite.
| Compound Name | bis(1-(2,4-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol);dihydroxyphosphanyl dihydrogen phosphite |
|---|---|
| PubChem CID | 158272519 |
| Molecular Formula | C38H68O13P2 |
| Molecular Weight | 794.90 g/mol |
| Exact Mass | 794.41 |
| IUPAC Name | bis(1-(2,4-ditert-butylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol);dihydroxyphosphanyl dihydrogen phosphite |
| SMILES | CC(C)(C)c1ccc(C(O)C(CO)(CO)CO)c(C(C)(C)C)c1.CC(C)(C)c1ccc(C(O)C(CO)(CO)CO)c(C(C)(C)C)c1.OP(O)OP(O)O |
| InChI | InChI=1S/2C19H32O4.H4O5P2/c2*1-17(2,3)13-7-8-14(15(9-13)18(4,5)6)16(23)19(10-20,11-21)12-22;1-6(2)5-7(3)4/h2*7-9,16,20-23H,10-12H2,1-6H3;1-4H |
| InChIKey | GJFDKVZDTULHAL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 251.99 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|