C33H55O8P — CID 69284409
2-[(2,4-ditert-butylphenoxy)-(2,4-ditert-butylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphoric acid (PubChem CID 69284409) has the molecular formula C33H55O8P and a molecular weight of 610.77 g/mol. Its IUPAC name is 2-[(2,4-ditert-butylphenoxy)-(2,4-ditert-butylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphoric acid.
| Compound Name | 2-[(2,4-ditert-butylphenoxy)-(2,4-ditert-butylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphoric acid |
|---|---|
| PubChem CID | 69284409 |
| Molecular Formula | C33H55O8P |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.36 |
| IUPAC Name | 2-[(2,4-ditert-butylphenoxy)-(2,4-ditert-butylphenyl)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphoric acid |
| SMILES | CC(C)(C)c1ccc(OC(c2ccc(C(C)(C)C)cc2C(C)(C)C)C(CO)(CO)CO)c(C(C)(C)C)c1.O=P(O)(O)O |
| InChI | InChI=1S/C33H52O4.H3O4P/c1-29(2,3)22-13-15-24(25(17-22)31(7,8)9)28(33(19-34,20-35)21-36)37-27-16-14-23(30(4,5)6)18-26(27)32(10,11)12;1-5(2,3)4/h13-18,28,34-36H,19-21H2,1-12H3;(H3,1,2,3,4) |
| InChIKey | LSARSXFDYJGYFP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|