C29H46LiO4P — CID 173031664
lithium;bis(2,4-ditert-butylphenyl)methyl dihydrogen phosphate;hydride (PubChem CID 173031664) has the molecular formula C29H46LiO4P and a molecular weight of 496.60 g/mol. Its IUPAC name is lithium;bis(2,4-ditert-butylphenyl)methyl dihydrogen phosphate;hydride.
| Compound Name | lithium;bis(2,4-ditert-butylphenyl)methyl dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 173031664 |
| Molecular Formula | C29H46LiO4P |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | lithium;bis(2,4-ditert-butylphenyl)methyl dihydrogen phosphate;hydride |
| SMILES | CC(C)(C)c1ccc(C(OP(=O)(O)O)c2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1.[H-].[Li+] |
| InChI | InChI=1S/C29H45O4P.Li.H/c1-26(2,3)19-13-15-21(23(17-19)28(7,8)9)25(33-34(30,31)32)22-16-14-20(27(4,5)6)18-24(22)29(10,11)12;;/h13-18,25H,1-12H3,(H2,30,31,32);;/q;+1;-1 |
| InChIKey | XNXAYJRGQCCKNT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|