C28H43O4PS — CID 140989157
(2,4-ditert-butylphenyl) (2,4-ditert-butyl-6-sulfanylphenyl) hydrogen phosphate (PubChem CID 140989157) has the molecular formula C28H43O4PS and a molecular weight of 506.69 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) (2,4-ditert-butyl-6-sulfanylphenyl) hydrogen phosphate.
| Compound Name | (2,4-ditert-butylphenyl) (2,4-ditert-butyl-6-sulfanylphenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 140989157 |
| Molecular Formula | C28H43O4PS |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (2,4-ditert-butylphenyl) (2,4-ditert-butyl-6-sulfanylphenyl) hydrogen phosphate |
| SMILES | CC(C)(C)c1ccc(OP(=O)(O)Oc2c(S)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H43O4PS/c1-25(2,3)18-13-14-22(20(15-18)27(7,8)9)31-33(29,30)32-24-21(28(10,11)12)16-19(17-23(24)34)26(4,5)6/h13-17,34H,1-12H3,(H,29,30) |
| InChIKey | QIHJPFONZMEZFI-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|