C30H47O4P — CID 140989155
(2,4-ditert-butyl-6-ethylidenecyclohexa-2,4-dien-1-yl) (2,4-ditert-butylphenyl) hydrogen phosphate (PubChem CID 140989155) has the molecular formula C30H47O4P and a molecular weight of 502.68 g/mol. Its IUPAC name is (2,4-ditert-butyl-6-ethylidenecyclohexa-2,4-dien-1-yl) (2,4-ditert-butylphenyl) hydrogen phosphate.
| Compound Name | (2,4-ditert-butyl-6-ethylidenecyclohexa-2,4-dien-1-yl) (2,4-ditert-butylphenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 140989155 |
| Molecular Formula | C30H47O4P |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | (2,4-ditert-butyl-6-ethylidenecyclohexa-2,4-dien-1-yl) (2,4-ditert-butylphenyl) hydrogen phosphate |
| SMILES | CC=C1C=C(C(C)(C)C)C=C(C(C)(C)C)C1OP(=O)(O)Oc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C30H47O4P/c1-14-20-17-22(28(5,6)7)19-24(30(11,12)13)26(20)34-35(31,32)33-25-16-15-21(27(2,3)4)18-23(25)29(8,9)10/h14-19,26H,1-13H3,(H,31,32) |
| InChIKey | VKHBJUOANQLQCQ-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|