C29H42NaO4P — CID 158188636
sodium [2-tert-butyl-4-(2-methylbut-3-en-2-yl)phenyl] (2,4-ditert-butylphenyl) phosphate (PubChem CID 158188636) has the molecular formula C29H42NaO4P and a molecular weight of 508.62 g/mol. Its IUPAC name is sodium [2-tert-butyl-4-(2-methylbut-3-en-2-yl)phenyl] (2,4-ditert-butylphenyl) phosphate.
| Compound Name | sodium [2-tert-butyl-4-(2-methylbut-3-en-2-yl)phenyl] (2,4-ditert-butylphenyl) phosphate |
|---|---|
| PubChem CID | 158188636 |
| Molecular Formula | C29H42NaO4P |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | sodium [2-tert-butyl-4-(2-methylbut-3-en-2-yl)phenyl] (2,4-ditert-butylphenyl) phosphate |
| SMILES | C=CC(C)(C)c1ccc(OP(=O)([O-])Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1.[Na+] |
| InChI | InChI=1S/C29H43O4P.Na/c1-13-29(11,12)21-15-17-25(23(19-21)28(8,9)10)33-34(30,31)32-24-16-14-20(26(2,3)4)18-22(24)27(5,6)7;/h13-19H,1H2,2-12H3,(H,30,31);/q;+1/p-1 |
| InChIKey | BSHDTTIHTJZTOF-UHFFFAOYSA-M |
| XLogP | 4.97 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|