C19H34O6P2 — CID 23201164
[1-(2,4-ditert-butylphenyl)-3-dihydroxyphosphanyloxy-2,2-dimethylpropyl] dihydrogen phosphite (PubChem CID 23201164) has the molecular formula C19H34O6P2 and a molecular weight of 420.42 g/mol. Its IUPAC name is [1-(2,4-ditert-butylphenyl)-3-dihydroxyphosphanyloxy-2,2-dimethylpropyl] dihydrogen phosphite.
| Compound Name | [1-(2,4-ditert-butylphenyl)-3-dihydroxyphosphanyloxy-2,2-dimethylpropyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 23201164 |
| Molecular Formula | C19H34O6P2 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [1-(2,4-ditert-butylphenyl)-3-dihydroxyphosphanyloxy-2,2-dimethylpropyl] dihydrogen phosphite |
| SMILES | CC(C)(C)c1ccc(C(OP(O)O)C(C)(C)COP(O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H34O6P2/c1-17(2,3)13-9-10-14(15(11-13)18(4,5)6)16(25-27(22)23)19(7,8)12-24-26(20)21/h9-11,16,20-23H,12H2,1-8H3 |
| InChIKey | KDBDDHKGLICVPJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|