C37H61O3P — CID 152709238
8,8-bis(2,4-ditert-butylphenyl)octyl methyl hydrogen phosphite (PubChem CID 152709238) has the molecular formula C37H61O3P and a molecular weight of 584.87 g/mol. Its IUPAC name is 8,8-bis(2,4-ditert-butylphenyl)octyl methyl hydrogen phosphite.
| Compound Name | 8,8-bis(2,4-ditert-butylphenyl)octyl methyl hydrogen phosphite |
|---|---|
| PubChem CID | 152709238 |
| Molecular Formula | C37H61O3P |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.44 |
| IUPAC Name | 8,8-bis(2,4-ditert-butylphenyl)octyl methyl hydrogen phosphite |
| SMILES | COP(O)OCCCCCCCC(c1ccc(C(C)(C)C)cc1C(C)(C)C)c1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C37H61O3P/c1-34(2,3)27-20-22-30(32(25-27)36(7,8)9)29(19-17-15-14-16-18-24-40-41(38)39-13)31-23-21-28(35(4,5)6)26-33(31)37(10,11)12/h20-23,25-26,29,38H,14-19,24H2,1-13H3 |
| InChIKey | XMLSJFDZGSLHTJ-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|