C33H57O8P — CID 159990326
bis(2,4-ditert-butylphenol);[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite (PubChem CID 159990326) has the molecular formula C33H57O8P and a molecular weight of 612.79 g/mol. Its IUPAC name is bis(2,4-ditert-butylphenol);[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite.
| Compound Name | bis(2,4-ditert-butylphenol);[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 159990326 |
| Molecular Formula | C33H57O8P |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 612.38 |
| IUPAC Name | bis(2,4-ditert-butylphenol);[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite |
| SMILES | CC(C)(C)c1ccc(O)c(C(C)(C)C)c1.CC(C)(C)c1ccc(O)c(C(C)(C)C)c1.OCC(CO)(CO)COP(O)O |
| InChI | InChI=1S/2C14H22O.C5H13O6P/c2*1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6;6-1-5(2-7,3-8)4-11-12(9)10/h2*7-9,15H,1-6H3;6-10H,1-4H2 |
| InChIKey | OGWFWGHUDUYDPY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|