C5H16O9P2 — CID 88505588
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;phosphorous acid (PubChem CID 88505588) has the molecular formula C5H16O9P2 and a molecular weight of 282.12 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;phosphorous acid.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;phosphorous acid |
|---|---|
| PubChem CID | 88505588 |
| Molecular Formula | C5H16O9P2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphite;phosphorous acid |
| SMILES | OCC(CO)(CO)COP(O)O.OP(O)O |
| InChI | InChI=1S/C5H13O6P.H3O3P/c6-1-5(2-7,3-8)4-11-12(9)10;1-4(2)3/h6-10H,1-4H2;1-3H |
| InChIKey | ZXYDCSAMGUMOOG-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|